1-Ethyl-3-methylpyridinium ethyl sulfate structure
|
Common Name | 1-Ethyl-3-methylpyridinium ethyl sulfate | ||
|---|---|---|---|---|
| CAS Number | 872672-50-9 | Molecular Weight | 247.311 | |
| Density | 1.22226 g/cm3 (25.00℃) | Boiling Point | N/A | |
| Molecular Formula | C10H17NO4S | Melting Point | <-65℃ | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-ethyl-3-methylpyridin-1-ium,ethyl sulfate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22226 g/cm3 (25.00℃) |
|---|---|
| Melting Point | <-65℃ |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.311 |
| Exact Mass | 247.087830 |
| PSA | 78.69000 |
| LogP | 1.86630 |
| Index of Refraction | 1.50666 (589.3 nm 25.00℃) |
| InChIKey | ZTLWMUBOQHZKNS-UHFFFAOYSA-M |
| SMILES | CCOS(=O)(=O)[O-].CC[n+]1cccc(C)c1 |
| Storage condition | 0-10°C |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Ethyl-3-methylpyridinium ethyl sulfate |
| E0681 |