Bromo(4-chlorophenyl)magnesium structure
|
Common Name | Bromo(4-chlorophenyl)magnesium | ||
|---|---|---|---|---|
| CAS Number | 873-77-8 | Molecular Weight | 215.758 | |
| Density | 0.887 g/mL at 25ºC | Boiling Point | N/A | |
| Molecular Formula | C6H4BrClMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | -40 °F | |
| Symbol |
GHS02, GHS05 |
Signal Word | Danger | |
| Name | 4-chlorophenylmagnesium bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 0.887 g/mL at 25ºC |
|---|---|
| Molecular Formula | C6H4BrClMg |
| Molecular Weight | 215.758 |
| Flash Point | -40 °F |
| Exact Mass | 213.903519 |
| LogP | 2.98580 |
| InChIKey | DLJIPJMUYCUTOV-UHFFFAOYSA-M |
| SMILES | Clc1cc[c-]cc1.[Br-].[Mg+2] |
| Storage condition | Flammables + water-Freezer (-20°C)e area |
| Water Solubility | It reacts violently with water. |
| Symbol |
GHS02, GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H314 |
| Supplemental HS | May form explosive peroxides., Reacts violently with water. |
| Precautionary Statements | P210-P280-P305 + P351 + P338-P310 |
| Hazard Codes | F+: Highly flammable;C: Corrosive; |
| Risk Phrases | R12 |
| Safety Phrases | 9-16-26-29-33-36/37/39-45 |
| RIDADR | UN 3399 4.3/PG 1 |
| WGK Germany | 1 |
| HS Code | 2931900090 |
|
~%
Bromo(4-chlorop... CAS#:873-77-8 |
| Literature: EP1398316 A2, ; Page 9 ; |
|
~%
Bromo(4-chlorop... CAS#:873-77-8 |
| Literature: US5610161 A1, ; |
|
~%
Bromo(4-chlorop... CAS#:873-77-8 |
| Literature: US5098923 A1, ; US 5098923 A |
|
~%
Bromo(4-chlorop... CAS#:873-77-8 |
| Literature: Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), , p. 464 - 467 |
|
~%
Bromo(4-chlorop... CAS#:873-77-8 |
| Literature: US5610161 A1, ; |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| magnesium,chlorobenzene,bromide |
| 4-CHLOROPHENYL MAGNESIUM BROMIDE |
| p-chlorophenylmagnesium bromide |
| bromo(p-chlorophenyl)magnesium |
| MFCD00009926 |
| 4-CHLOROPHENYLMAGNESIUMBROMIDE |
| 4-Chlorophenylmagnesium bromide |
| EINECS 212-853-8 |
| Bromo(4-chlorophenyl)magnesium |
| (4-Chlorophenyl)magnesium bromide |