3,29-Dibenzoyl karounitriol structure
|
Common Name | 3,29-Dibenzoyl karounitriol | ||
|---|---|---|---|---|
| CAS Number | 873001-54-8 | Molecular Weight | 666.928 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 706.5±60.0 °C at 760 mmHg | |
| Molecular Formula | C44H58O5 | Melting Point | 162-164ºC | |
| MSDS | N/A | Flash Point | 203.9±26.4 °C | |
Use of 3,29-Dibenzoyl karounitriol3,29-Dibenzoyl rarounitriol is one major bioactive compound of multiflorane triterpene esters Trichosanthes kirilowii, can be chosen as the marker for quantitation of Trichosanthes kirilowii[1]. |
| Name | 3,29-Dibenzoyl rarounitriol |
|---|---|
| Synonym | More Synonyms |
| Description | 3,29-Dibenzoyl rarounitriol is one major bioactive compound of multiflorane triterpene esters Trichosanthes kirilowii, can be chosen as the marker for quantitation of Trichosanthes kirilowii[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 706.5±60.0 °C at 760 mmHg |
| Melting Point | 162-164ºC |
| Molecular Formula | C44H58O5 |
| Molecular Weight | 666.928 |
| Flash Point | 203.9±26.4 °C |
| Exact Mass | 666.428406 |
| PSA | 72.83000 |
| LogP | 13.08 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | ZRKGVMOZKMBTHF-DUVCPVCPSA-N |
| SMILES | CC1(COC(=O)c2ccccc2)CCC2(C)CCC3(C)C4=C(CCC3(C)C2C1)C1(C)CCC(OC(=O)c2ccccc2)C(C)(C)C1CC4O |
| Storage condition | 2~8℃ |
| Hazard Codes | Xi |
|---|
| [(2R,4aS,6aS,7S,8aR,10R,12aS,14aS,14bR)-10-(Benzoyloxy)-7-hydroxy-2,4a,6a,9,9,12a,14a-heptamethyl-1,2,3,4,4a,5,6,6a,7,8,8a,9,10,11,12,12a,13,14,14a,14b-icosahydro-2-picenyl]methyl benzoate |
| 3,6-Picenediol, 11-[(benzoyloxy)methyl]-1,2,3,4,4a,5,6,6b,7,8,8a,9,10,11,12,12a,12b,13,14,14b-eicosahydro-4,4,6b,8a,11,12b,14b-heptamethyl-, 3-benzoate, (3R,4aR,6S,6bS,8aS,11R,12aR,12bS,14bS)- |