N-(5-BROMO-PYRIDIN-3-YL)-2,2-DIMETHYL-PROPIONAMIDE structure
|
Common Name | N-(5-BROMO-PYRIDIN-3-YL)-2,2-DIMETHYL-PROPIONAMIDE | ||
|---|---|---|---|---|
| CAS Number | 873302-39-7 | Molecular Weight | 257.12700 | |
| Density | 1.416g/cm3 | Boiling Point | 365.7ºC at 760 mmHg | |
| Molecular Formula | C10H13BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-(5-bromopyridin-3-yl)-2,2-dimethylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.416g/cm3 |
|---|---|
| Boiling Point | 365.7ºC at 760 mmHg |
| Molecular Formula | C10H13BrN2O |
| Molecular Weight | 257.12700 |
| Flash Point | 175ºC |
| Exact Mass | 256.02100 |
| PSA | 41.99000 |
| LogP | 2.90170 |
| Index of Refraction | 1.577 |
| InChIKey | OKUYTVHRBWHVQU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Nc1cncc(Br)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
|
~72%
N-(5-BROMO-PYRI... CAS#:873302-39-7 |
| Literature: Samumed, LLC; Hood, John; Kumar KC, Sunil; Wallace, David Mark Patent: US2013/296302 A1, 2013 ; Location in patent: Paragraph 0517 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Bromo-3-N-pivaloyl-aminopyridine |