1-(2,4,6-trimethylphenyl)pyridin-1-ium-3-carboxamide,chloride structure
|
Common Name | 1-(2,4,6-trimethylphenyl)pyridin-1-ium-3-carboxamide,chloride | ||
|---|---|---|---|---|
| CAS Number | 87399-14-2 | Molecular Weight | 276.76100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,4,6-trimethylphenyl)pyridin-1-ium-3-carboxamide,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H17ClN2O |
|---|---|
| Molecular Weight | 276.76100 |
| Exact Mass | 276.10300 |
| PSA | 50.79000 |
| LogP | 3.54610 |
| InChIKey | QFSFSGZCPMULHV-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(-[n+]2cccc(C(N)=O)c2)c(C)c1.[Cl-] |
|
~51%
1-(2,4,6-trimet... CAS#:87399-14-2 |
| Literature: Angelino, S. A. G. F.; Buurman, D. J.; Plas, H. C. van der; Mueller, F. Recueil: Journal of the Royal Netherlands Chemical Society, 1983 , vol. 102, # 6 p. 331 - 336 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-carbamoyl-1-(2,4,6-trimethylphenyl) pyridinium chloride |
| Pyridinium,3-(aminocarbonyl)-1-(2,4,6-trimethylphenyl)-,chloride |