1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene
1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene structure
|
Common Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene | ||
|---|---|---|---|---|
| CAS Number | 87405-83-2 | Molecular Weight | 496.16200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H5F17 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H5F17 |
|---|---|
| Molecular Weight | 496.16200 |
| Exact Mass | 496.01200 |
| LogP | 7.15250 |
| InChIKey | CYLIQDNNFMKOLN-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
CAS#:591-50-4
CAS#:507-63-1
CAS#:71-43-2
CAS#:108-90-7
CAS#:353-59-3
CAS#:52717-17-6
CAS#:3829-39-8
CAS#:41049-21-2
CAS#:335-64-8This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzene,(heptadecafluorooctyl) |
| (heptadecafluorooctyl)benzene |
| (perfluorooctyl)benzene |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene? |
| A: Molecular formula of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene is C14H5F17. |
| Q: What is the InChIKey of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene? |
| A: InChIKey of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene is CYLIQDNNFMKOLN-UHFFFAOYSA-N. |
| Q: What English synonyms does 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene have? |
| A: English synonyms of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene: Benzene,(heptadecafluorooctyl), (heptadecafluorooctyl)benzene, (perfluorooctyl)benzene. |
| Q: What is the LogP of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene? |
| A: LogP of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene is 7.15250. |
| Q: What are the upstream materials of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene? |
| A: Related upstream materials(CAS) of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene: 591-50-4;507-63-1;71-43-2;108-90-7;353-59-3;52717-17-6;3829-39-8;41049-21-2;335-64-8. |
| Q: What is the SMILES notation of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene? |
| A: SMILES notation of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene is FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ccccc1. |
| Q: What is the Chinese name of 87405-83-2? |
| A: Chinese name of 87405-83-2 is 87405-83-2. |
| Q: What is the CAS number of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene? |
| A: CAS number of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene is 87405-83-2. |
| Q: What is the molecular weight of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene? |
| A: Molecular weight of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene is 496.16200. |
| Q: What is the English name of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene? |
| A: The English name of 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene is 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctylbenzene. |