Perfluorooctyl iodide structure
|
Common Name | Perfluorooctyl iodide | ||
|---|---|---|---|---|
| CAS Number | 507-63-1 | Molecular Weight | 545.963 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 160.6±8.0 °C at 760 mmHg | |
| Molecular Formula | C8F17I | Melting Point | 25 °C | |
| MSDS | Chinese USA | Flash Point | 68.6±5.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Perfluorooctyl iodide |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 160.6±8.0 °C at 760 mmHg |
| Melting Point | 25 °C |
| Molecular Formula | C8F17I |
| Molecular Weight | 545.963 |
| Flash Point | 68.6±5.6 °C |
| Exact Mass | 545.877319 |
| LogP | 9.00 |
| Vapour Pressure | 3.1±0.3 mmHg at 25°C |
| Index of Refraction | 1.324 |
| InChIKey | KWXGJTSJUKTDQU-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)I |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | UN 2922 |
| WGK Germany | 3 |
| RTECS | RG9700050 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
|
Structure and energetics of gas phase halogen-bonding in mono-, bi-, and tri-dentate anion receptors as studied by BIRD.
Phys. Chem. Chem. Phys. 15(20) , 7638-47, (2013) Complexes of mono-, bi- (RB), and tridentate (RT) receptors with a range of anions (Cl(-), Br(-), I(-), NO3(-), H2PO4(-), HSO4(-), and tosylate (TsO(-))) have been studied in the gas phase by both exp... |
| Perfluoro-1-iodooctane |
| Octane, 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-heptadecafluoro-8-iodo- |
| Heptadecafluorooctyl iodide |
| MFCD00001064 |
| Perfluorooctyl iodide |
| Heptadecafluoro-1-iodooctane |
| 1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8-Heptadecafluoro-8-iodooctane |
| Heptadecafluoro-n-octyl Iodide |
| EINECS 208-079-5 |
| Perfluoro-n-Octyl Iodide |