4-(Ethoxycarbonyl)-3-nitrobenzoic acid
Modify Date: 2025-09-17 19:03:45
4-(Ethoxycarbonyl)-3-nitrobenzoic acid structure
|
Common Name | 4-(Ethoxycarbonyl)-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 87424-40-6 | Molecular Weight | 239.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(Ethoxycarbonyl)-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H9NO6 |
|---|---|
| Molecular Weight | 239.18200 |
| Exact Mass | 239.04300 |
| PSA | 109.42000 |
| LogP | 1.99290 |
| InChIKey | VOFZDDBVIFBHIJ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(C(=O)O)cc1[N+](=O)[O-] |
| HS Code | 2918990090 |
|---|
|
~%
4-(Ethoxycarbon... CAS#:87424-40-6 |
| Literature: Cohen; de Pennington Journal of the Chemical Society, 1918 , vol. 113, p. 63 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-ethoxycarbonyl-3-nitrobenzoic acid |