4-(dimethylamino)-3-nitrobenzoic acid structure
|
Common Name | 4-(dimethylamino)-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 28096-56-2 | Molecular Weight | 210.18700 | |
| Density | 1.384g/cm3 | Boiling Point | 383.5ºC at 760mmHg | |
| Molecular Formula | C9H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.8ºC | |
| Name | 4-(dimethylamino)-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.384g/cm3 |
|---|---|
| Boiling Point | 383.5ºC at 760mmHg |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.18700 |
| Flash Point | 185.8ºC |
| Exact Mass | 210.06400 |
| PSA | 86.36000 |
| LogP | 1.88220 |
| Vapour Pressure | 1.44E-06mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | ZXBMWJZLUDXEPS-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(=O)O)cc1[N+](=O)[O-] |
| HS Code | 2922499990 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|
Name: Agonist activity at human GPR109b receptor transfected in CHOK1 cells assessed as rev...
Source: ChEMBL
Target: Hydroxycarboxylic acid receptor 3
External Id: CHEMBL899918
|
|
Name: Agonist activity at human GPR109a receptor transfected in CHOK1 cells at 30 uM assess...
Source: ChEMBL
Target: Hydroxycarboxylic acid receptor 2
External Id: CHEMBL899919
|
| 4-(N,N-dimethylamino)-3-nitrobenzoic acid |
| 4-dimethylamino-3-nitrobenzoic acid |
| 4-Dimethylamino-3-nitro-benzoesaeure |
| 3-Nitro-4-dimethylaminobenzoesaeure |