Tributyl-3-furanyl-stannane structure
|
Common Name | Tributyl-3-furanyl-stannane | ||
|---|---|---|---|---|
| CAS Number | 87453-06-3 | Molecular Weight | 357.11000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H30OSn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tributyl(furan-3-yl)stannane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H30OSn |
|---|---|
| Molecular Weight | 357.11000 |
| Exact Mass | 358.13200 |
| PSA | 9.23000 |
| LogP | 5.04180 |
| InChIKey | VTEKJMLRRQTTAX-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1ccoc1 |
|
~85%
Tributyl-3-fura... CAS#:87453-06-3 |
| Literature: Pinhey, John T.; Roche, Eric G. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 2415 - 2422 |
|
~22%
Tributyl-3-fura... CAS#:87453-06-3 |
| Literature: Yang, Yun; Wong, Henry N. C. Journal of the Chemical Society, Chemical Communications, 1992 , # 8 p. 656 - 658 |
| Precursor 4 | |
|---|---|
| DownStream 8 | |
| Stannane,tributyl-3-furanyl |
| 3-(tributylstannyl)furan |
| (3-furanyl)-tributylstannane |
| 3-furyl tributylstannane |
| tributyl(3-furyl)stannane |
| 3-(tri-n-butylstannyl)furan |