bis(tri-n-butylstannyl)acetylene structure
|
Common Name | bis(tri-n-butylstannyl)acetylene | ||
|---|---|---|---|---|
| CAS Number | 994-71-8 | Molecular Weight | 604.10900 | |
| Density | 1.147 g/mL at 25 °C(lit.) | Boiling Point | 497.5ºC at 760mmHg | |
| Molecular Formula | C26H54Sn2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 254.3ºC | |
| Symbol |
GHS06, GHS08, GHS09 |
Signal Word | Danger | |
| Name | tributyl(2-tributylstannylethynyl)stannane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.147 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 497.5ºC at 760mmHg |
| Molecular Formula | C26H54Sn2 |
| Molecular Weight | 604.10900 |
| Flash Point | 254.3ºC |
| Exact Mass | 606.22700 |
| LogP | 9.76640 |
| Index of Refraction | n20/D 1.493(lit.) |
| InChIKey | CAUONNQGFXOEMY-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](C#C[Sn](CCCC)(CCCC)CCCC)(CCCC)CCCC |
| Symbol |
GHS06, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H312-H315-H319-H372-H410 |
| Precautionary Statements | P273-P280-P301 + P310-P305 + P351 + P338-P314-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | R21 |
| Safety Phrases | 35-36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1/PG 3 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 6.1(b) |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,2-bis(tributylstannyl)acetylene |
| 1,2-bis(tri-n-butylstannyl)acetylene |
| MFCD00010239 |
| OR7761 |
| 1,2-bis(tri-n-butylstannyl)ethyne |
| bis-(tributylstannyl)acetylene |
| bis(tributylstannyl)ethyne |
| Bis(tri-n-butylstannyl)acetylene |
| 1,2-bis(tributylstannyl)ethyne |