cis-3,4-Dihydroxy-β-ionone
Modify Date: 2026-07-14 12:17:42
cis-3,4-Dihydroxy-β-ionone structure
|
Common Name | cis-3,4-Dihydroxy-β-ionone | ||
|---|---|---|---|---|
| CAS Number | 875666-39-0 | Molecular Weight | 224.296 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 361.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.8±24.4 °C | |
| Name | (E)-4-((3R,4S)-3,4-dihydroxy-2,6,6-trimethylcyclohex-1-en-1-yl)but-3-en-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 361.8±42.0 °C at 760 mmHg |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.296 |
| Flash Point | 186.8±24.4 °C |
| Exact Mass | 224.141251 |
| PSA | 57.53000 |
| LogP | 0.89 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.570 |
| InChIKey | FXRGLHAKDUTPCV-CYLBZQBVSA-N |
| SMILES | CC(=O)C=CC1=C(C)C(O)C(O)CC1(C)C |
| Hazard Codes | Xi |
|---|
|
Name: Inhibition of Saccharomyces cerevisiae alpha-glucosidase using p-nitro-phenyl-alpha-D...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4184663
|
|
Name: Inhibition of Saccharomyces cerevisiae alpha-glucosidase using p-nitro-phenyl-alpha-D...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4184662
|
Total 2, Current Page 1 of 1
1
| (3E)-4-[(3R,4S)-3,4-Dihydroxy-2,6,6-trimethyl-1-cyclohexen-1-yl]-3-buten-2-one |