Urea,N-methyl-N'-[3-(2-methyl-1,3-oxathiolan-2-yl)phenyl]- structure
|
Common Name | Urea,N-methyl-N'-[3-(2-methyl-1,3-oxathiolan-2-yl)phenyl]- | ||
|---|---|---|---|---|
| CAS Number | 87623-19-6 | Molecular Weight | 252.33300 | |
| Density | 1.238g/cm3 | Boiling Point | 395.4ºC at 760 mmHg | |
| Molecular Formula | C12H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.9ºC | |
| Name | 1-methyl-3-[3-(2-methyl-1,3-oxathiolan-2-yl)phenyl]urea |
|---|
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 395.4ºC at 760 mmHg |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.33300 |
| Flash Point | 192.9ºC |
| Exact Mass | 252.09300 |
| PSA | 75.66000 |
| LogP | 2.83790 |
| Index of Refraction | 1.608 |
| InChIKey | CUTYUASQPSPNRU-UHFFFAOYSA-N |
| SMILES | CNC(=O)Nc1cccc(C2(C)OCCS2)c1 |
|
~77%
Urea,N-methyl-N... CAS#:87623-19-6 |
| Literature: Witek, Stanislaw; Bielawski, Jacek; Bielawska, Alicja Polish Journal of Chemistry, 1981 , vol. 55, # 11 p. 2315 - 2326 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |