3-methyl-2-(3-pyridyl)-1-indoleoctanoic acid structure
|
Common Name | 3-methyl-2-(3-pyridyl)-1-indoleoctanoic acid | ||
|---|---|---|---|---|
| CAS Number | 87627-28-9 | Molecular Weight | 350.45400 | |
| Density | 1.12g/cm3 | Boiling Point | 564ºC at 760 mmHg | |
| Molecular Formula | C22H26N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 294.9ºC | |
| Name | 8-(3-methyl-2-pyridin-3-ylindol-1-yl)octanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 564ºC at 760 mmHg |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.45400 |
| Flash Point | 294.9ºC |
| Exact Mass | 350.19900 |
| PSA | 55.12000 |
| LogP | 5.43690 |
| Index of Refraction | 1.59 |
| InChIKey | CVVKIXNPXDBREE-UHFFFAOYSA-N |
| SMILES | Cc1c(-c2cccnc2)n(CCCCCCCC(=O)O)c2ccccc12 |
| HS Code | 2933990090 |
|---|
|
~%
3-methyl-2-(3-p... CAS#:87627-28-9 |
| Literature: Ciba-Geigy Corporation Patent: US4460777 A1, 1984 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-1-octanoic acid,3-methyl-2-(3-pyridinyl) |
| 8-[3-methyl-2-(3-pyridyl)-1H-indol-1-yl]octanoic acid |
| 3-methyl-2-(pyridin-3-yl)indole-1-octanoic acid |
| 3-Methyl-2-(3-pyridinyl)-1H-indole-1-octanoic acid |
| 8-[3-methyl-2-(pyridin-3-yl)-1H-indol-1-yl]octanoic acid |
| 3-Methyl-2-(3-pyridyl)-1-indoleoctanoic acid |
| 1-(7-carboxyheptyl)-3-methyl-2-(pyridin-3-yl)indole |