Dimethyl 4-bromophthalate structure
|
Common Name | Dimethyl 4-bromophthalate | ||
|---|---|---|---|---|
| CAS Number | 87639-57-4 | Molecular Weight | 273.080 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 305.1±22.0 °C at 760 mmHg | |
| Molecular Formula | C10H9BrO4 | Melting Point | 38-40°C | |
| MSDS | N/A | Flash Point | 138.3±22.3 °C | |
| Name | Dimethyl 4-bromophthalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 305.1±22.0 °C at 760 mmHg |
| Melting Point | 38-40°C |
| Molecular Formula | C10H9BrO4 |
| Molecular Weight | 273.080 |
| Flash Point | 138.3±22.3 °C |
| Exact Mass | 271.968414 |
| PSA | 52.60000 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | AMNIKUDFXYWYSY-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(Br)cc1C(=O)OC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917399090 |
|
~68%
Dimethyl 4-brom... CAS#:87639-57-4 |
| Literature: Eisai Co., Ltd. Patent: US2002/19531 A1, 2002 ; US 20020019531 A1 |
|
~%
Dimethyl 4-brom... CAS#:87639-57-4 |
| Literature: Journal fuer Praktische Chemie (Leipzig), , vol. <2> 126, p. 69,72 |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,2-Benzenedicarboxylic acid, 4-bromo-, dimethyl ester |
| dimethyl 4-bromobenzene-1,2-dicarboxylate |
| Dimethyl 4-bromophthalate |