Nurr1 agonist 4 structure
|
Common Name | Nurr1 agonist 4 | ||
|---|---|---|---|---|
| CAS Number | 87645-58-7 | Molecular Weight | 218.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Nurr1 agonist 4Nurr1 agonist 4 (compound 8) is a high-affinity Nurr1 agonist with EC50 of 2.1 μM[1]. |
| Name | 5-(4-methoxyphenyl)furan-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Nurr1 agonist 4 (compound 8) is a high-affinity Nurr1 agonist with EC50 of 2.1 μM[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C12H10O4 |
|---|---|
| Molecular Weight | 218.21 |
| Exact Mass | 218.05800 |
| PSA | 59.67000 |
| LogP | 2.65340 |
| InChIKey | KGKSJJKOSONHJU-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2cc(C(=O)O)co2)cc1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-Furancarboxylic acid,5-(4-methoxyphenyl) |
| 2-(p-Anisyl)furan-4-carboxylic acid |