2-hydroxy-6-isobutylpyrimidine-4-carboxylic acid
Modify Date: 2025-08-25 11:15:24
2-hydroxy-6-isobutylpyrimidine-4-carboxylic acid structure
|
Common Name | 2-hydroxy-6-isobutylpyrimidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 876715-59-2 | Molecular Weight | 196.20300 | |
| Density | 1.32g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(2-methylpropyl)-2-oxo-1H-pyrimidine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.20300 |
| Exact Mass | 196.08500 |
| PSA | 83.31000 |
| LogP | 1.07890 |
| Index of Refraction | 1.585 |
| InChIKey | WDIFSCKLWBVBLR-UHFFFAOYSA-N |
| SMILES | CC(C)Cc1cc(C(=O)O)nc(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| BB_NC-2535 |
| 2-HYDROXY-6-ISOBUTYLPYRIMIDINE-4-CARBOXYLIC ACID |
| 2-hydroxy-6-(2-methylpropyl)pyrimidine-4-carboxylic acid |