3,5,7-trimethyl-1h-indole-2-carboxylic acid structure
|
Common Name | 3,5,7-trimethyl-1h-indole-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 876715-82-1 | Molecular Weight | 203.23700 | |
| Density | 1.245g/cm3 | Boiling Point | 416ºC at 760 mmHg | |
| Molecular Formula | C12H13NO2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 205.4ºC | |
| Name | 3,5,7-trimethyl-1h-indole-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 416ºC at 760 mmHg |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.23700 |
| Flash Point | 205.4ºC |
| Exact Mass | 203.09500 |
| PSA | 53.09000 |
| LogP | 2.79130 |
| Index of Refraction | 1.655 |
| InChIKey | XFNONUNNILCXRU-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c2[nH]c(C(=O)O)c(C)c2c1 |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,5,7-trimethylindole-2-carboxylic acid |