methyl 3-(3-chloro-2,4-dihydroxyphenyl)propanoate structure
|
Common Name | methyl 3-(3-chloro-2,4-dihydroxyphenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 876746-33-7 | Molecular Weight | 230.64500 | |
| Density | 1.376g/cm3 | Boiling Point | 342.85ºC at 760 mmHg | |
| Molecular Formula | C10H11ClO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.15ºC | |
| Name | methyl 3-(3-chloro-2,4-dihydroxyphenyl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.376g/cm3 |
|---|---|
| Boiling Point | 342.85ºC at 760 mmHg |
| Molecular Formula | C10H11ClO4 |
| Molecular Weight | 230.64500 |
| Flash Point | 161.15ºC |
| Exact Mass | 230.03500 |
| PSA | 66.76000 |
| LogP | 1.85680 |
| Index of Refraction | 1.577 |
| InChIKey | WDROVRBYCGCSTE-UHFFFAOYSA-N |
| SMILES | COC(=O)CCc1ccc(O)c(Cl)c1O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| Methyl3-(3-chloro-2,4-dihydroxyphenyl)propionate |
| Benzenepropanoic acid,3-chloro-2,4-dihydroxy-,methyl ester |