4-(2,4,6-trimethylphenoxy)benzonitrile structure
|
Common Name | 4-(2,4,6-trimethylphenoxy)benzonitrile | ||
|---|---|---|---|---|
| CAS Number | 876746-92-8 | Molecular Weight | 237.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2,4,6-trimethylphenoxy)benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H15NO |
|---|---|
| Molecular Weight | 237.29600 |
| Exact Mass | 237.11500 |
| PSA | 33.02000 |
| LogP | 4.27578 |
| InChIKey | XKZBQWTUDKGABV-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(Oc2ccc(C#N)cc2)c(C)c1 |
|
~95%
4-(2,4,6-trimet... CAS#:876746-92-8 |
| Literature: The United States of America as represented by the Secretary of the Air Force Patent: US7732642 B1, 2010 ; Location in patent: Page/Page column 3-4 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzonitrile,4-(2,4,6-trimethylphenoxy) |