Cilastatin ammonium salt structure
|
Common Name | Cilastatin ammonium salt | ||
|---|---|---|---|---|
| CAS Number | 877674-82-3 | Molecular Weight | 375.48 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H29N3O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Cilastatin ammonium salt |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H29N3O5S |
|---|---|
| Molecular Weight | 375.48 |
| Appearance of Characters | neat |
| InChIKey | PEHMSHKUJVYVPY-QBNHLFMHSA-N |
| SMILES | CC1(C)CC1C(=O)NC(=CCCCCSCC(N)C(=O)O)C(=O)[O-].[NH4+] |
| Storage condition | 2-8°C |
| RIDADR | NONH for all modes of transport |
|---|
| MFCD26142864 |