2,2-dichloro-N-[2-methyl-4-(2-methylpropyl)-1,3-oxazol-5-yl]acetamide structure
|
Common Name | 2,2-dichloro-N-[2-methyl-4-(2-methylpropyl)-1,3-oxazol-5-yl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 87783-74-2 | Molecular Weight | 265.13600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2-dichloro-N-[2-methyl-4-(2-methylpropyl)-1,3-oxazol-5-yl]acetamide |
|---|
| Molecular Formula | C10H14Cl2N2O2 |
|---|---|
| Molecular Weight | 265.13600 |
| Exact Mass | 264.04300 |
| PSA | 58.62000 |
| LogP | 3.57320 |
| InChIKey | WLUHKIAJVDAECU-UHFFFAOYSA-N |
| SMILES | Cc1nc(CC(C)C)c(NC(=O)C(Cl)Cl)o1 |
|
~45%
2,2-dichloro-N-... CAS#:87783-74-2 |
| Literature: Lipshutz, Bruce H.; Hungate, Randall W.; NcCarthy, Keith E. Journal of the American Chemical Society, 1983 , vol. 105, # 26 p. 7703 - 7713 |
|
~%
2,2-dichloro-N-... CAS#:87783-74-2 |
| Literature: Lipshutz, Bruce H.; Hungate, Randall W.; NcCarthy, Keith E. Journal of the American Chemical Society, 1983 , vol. 105, # 26 p. 7703 - 7713 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |