1-(4-methylphenyl)-3-pyrrolidin-1-ylpropan-1-one structure
|
Common Name | 1-(4-methylphenyl)-3-pyrrolidin-1-ylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 87849-03-4 | Molecular Weight | 217.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methylphenyl)-3-pyrrolidin-1-ylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H19NO |
|---|---|
| Molecular Weight | 217.30700 |
| Exact Mass | 217.14700 |
| PSA | 20.31000 |
| LogP | 2.60150 |
| InChIKey | KKCZPVROBRXZKM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(=O)CCN2CCCC2)cc1 |
|
~74%
1-(4-methylphen... CAS#:87849-03-4 |
| Literature: HIKAL LIMITED Patent: WO2009/84035 A1, 2009 ; Location in patent: Page/Page column 5; 8-9 ; |
|
~%
1-(4-methylphen... CAS#:87849-03-4 |
| Literature: Adamson et al. Journal of the Chemical Society, 1958 , p. 312,315 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| 4'-methyl-3-pyrrolidino propiophenone |
| 3-pyrrolidino-1-p-tolyl-propan-1-one |