2-CHLORO-N-[2-(DIETHYLAMINO)ETHYL]-4-QUINOLINECARBOXAMIDE structure
|
Common Name | 2-CHLORO-N-[2-(DIETHYLAMINO)ETHYL]-4-QUINOLINECARBOXAMIDE | ||
|---|---|---|---|---|
| CAS Number | 87864-14-0 | Molecular Weight | 305.802 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 470.5±40.0 °C at 760 mmHg | |
| Molecular Formula | C16H20ClN3O | Melting Point | 65-67ºC | |
| MSDS | N/A | Flash Point | 238.3±27.3 °C | |
| Name | 2-chloro-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 470.5±40.0 °C at 760 mmHg |
| Melting Point | 65-67ºC |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.802 |
| Flash Point | 238.3±27.3 °C |
| Exact Mass | 305.129486 |
| PSA | 45.23000 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.592 |
| InChIKey | WZBLJANCSMJDSS-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCNC(=O)c1cc(Cl)nc2ccccc12 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933499090 |
|
~%
2-CHLORO-N-[2-(... CAS#:87864-14-0 |
| Literature: DE537104 , ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 18, p. 2734 |
|
~%
2-CHLORO-N-[2-(... CAS#:87864-14-0 |
| Literature: Glasnik Hemijskog Drustva Beograd, , vol. 20, p. 553,554 Chem.Abstr., , p. 16395 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Quinolinecarboxamide, 2-chloro-N-[2-(diethylamino)ethyl]- |
| Desbutoxy 2-Chloro Dibucaine |
| 2-Chloro-N-[2-(diethylamino)ethyl]quinoline-4-carboxamide |
| 4-Quinolinecarboximidic acid, 2-chloro-N-[2-(diethylamino)ethyl]- |
| L249 |
| 2-Chloro-N-[2-(diethylamino)ethyl]-4-quinolinecarboximidic acid |
| 2-Chloro-N-[2-(diethylamino)ethyl]-4-quinolinecarboxamide |
| AC-1506 |