CHEMBRDG-BB 9071300
Modify Date: 2025-11-26 18:12:42
CHEMBRDG-BB 9071300 structure
|
Common Name | CHEMBRDG-BB 9071300 | ||
|---|---|---|---|---|
| CAS Number | 878668-66-7 | Molecular Weight | 218.21200 | |
| Density | 1.46g/cm3 | Boiling Point | 350.2ºC at 760 mmHg | |
| Molecular Formula | C10H10N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.6ºC | |
| Name | 3-(2-hydroxyanilino)-6-methyl-2H-1,2,4-triazin-5-one |
|---|
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 350.2ºC at 760 mmHg |
| Molecular Formula | C10H10N4O2 |
| Molecular Weight | 218.21200 |
| Flash Point | 165.6ºC |
| Exact Mass | 218.08000 |
| PSA | 90.90000 |
| LogP | 0.99550 |
| Index of Refraction | 1.694 |
| InChIKey | ZPAKDBICYBWQCL-UHFFFAOYSA-N |
| SMILES | Cc1nnc(Nc2ccccc2O)[nH]c1=O |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |