methyl 2-trifluoromethyl-4-pyrimidine carboxylate structure
|
Common Name | methyl 2-trifluoromethyl-4-pyrimidine carboxylate | ||
|---|---|---|---|---|
| CAS Number | 878745-51-8 | Molecular Weight | 206.12200 | |
| Density | 1.29g/cm3 | Boiling Point | 163.8ºC at 760 mmHg | |
| Molecular Formula | C7H5F3N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 52.9ºC | |
| Name | Methyl 2-(trifluoromethyl)pyrimidine-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 163.8ºC at 760 mmHg |
| Molecular Formula | C7H5F3N2O2 |
| Molecular Weight | 206.12200 |
| Flash Point | 52.9ºC |
| Exact Mass | 206.03000 |
| PSA | 52.08000 |
| LogP | 1.28200 |
| Index of Refraction | 1.436 |
| InChIKey | VBFLWQBZJODKRL-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccnc(C(F)(F)F)n1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 2-(trifluoromethyl)pyrimidine-4-carboxylate |