1-(3,4-dichlorophenyl)-3-(3-hydroxypropyl)urea structure
|
Common Name | 1-(3,4-dichlorophenyl)-3-(3-hydroxypropyl)urea | ||
|---|---|---|---|---|
| CAS Number | 87919-21-9 | Molecular Weight | 263.12000 | |
| Density | 1.416g/cm3 | Boiling Point | 396.8ºC at 760mmHg | |
| Molecular Formula | C10H12Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.8ºC | |
| Name | 1-(3,4-dichlorophenyl)-3-(3-hydroxypropyl)urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.416g/cm3 |
|---|---|
| Boiling Point | 396.8ºC at 760mmHg |
| Molecular Formula | C10H12Cl2N2O2 |
| Molecular Weight | 263.12000 |
| Flash Point | 193.8ºC |
| Exact Mass | 262.02800 |
| PSA | 64.85000 |
| LogP | 2.77470 |
| Index of Refraction | 1.613 |
| InChIKey | XFKZYUOOMFMGLG-UHFFFAOYSA-N |
| SMILES | O=C(NCCCO)Nc1ccc(Cl)c(Cl)c1 |
|
~58%
1-(3,4-dichloro... CAS#:87919-21-9 |
| Literature: Leonov; Shcherbakov; Devichensky; Kryukova; Vorontsov; Kuznetsov; Kryukov Russian Journal of Bioorganic Chemistry, 2001 , vol. 27, # 3 p. 191 - 194 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| f0017-0286 |