1-(3,4-dichlorophenyl)-3-(2-hydroxypropyl)urea
Modify Date: 2025-09-19 21:32:15
1-(3,4-dichlorophenyl)-3-(2-hydroxypropyl)urea structure
|
Common Name | 1-(3,4-dichlorophenyl)-3-(2-hydroxypropyl)urea | ||
|---|---|---|---|---|
| CAS Number | 87919-26-4 | Molecular Weight | 263.12000 | |
| Density | 1.413g/cm3 | Boiling Point | 380.9ºC at 760 mmHg | |
| Molecular Formula | C10H12Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.1ºC | |
| Name | 1-(3,4-dichlorophenyl)-3-(2-hydroxypropyl)urea |
|---|
| Density | 1.413g/cm3 |
|---|---|
| Boiling Point | 380.9ºC at 760 mmHg |
| Molecular Formula | C10H12Cl2N2O2 |
| Molecular Weight | 263.12000 |
| Flash Point | 184.1ºC |
| Exact Mass | 262.02800 |
| PSA | 64.85000 |
| LogP | 2.77310 |
| Index of Refraction | 1.611 |
| InChIKey | DDQPHMVEYIHWOZ-UHFFFAOYSA-N |
| SMILES | CC(O)CNC(=O)Nc1ccc(Cl)c(Cl)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |