p-Hydroxyphenethyl anisate structure
|
Common Name | p-Hydroxyphenethyl anisate | ||
|---|---|---|---|---|
| CAS Number | 87932-34-1 | Molecular Weight | 272.296 | |
| Density | 1.199±0.06 g/cm3 | Boiling Point | 446.5±30.0 °C at 760 mmHg | |
| Molecular Formula | C16H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.4±18.1 °C | |
Use of p-Hydroxyphenethyl anisatep-Hydroxyphenethyl anisate is a main constituent of Notopterygium Radix[1]. |
| Name | 2-(4-hydroxyphenyl)ethyl 4-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Description | p-Hydroxyphenethyl anisate is a main constituent of Notopterygium Radix[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.199±0.06 g/cm3 |
|---|---|
| Boiling Point | 446.5±30.0 °C at 760 mmHg |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.296 |
| Flash Point | 165.4±18.1 °C |
| Exact Mass | 272.104858 |
| PSA | 55.76000 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | DSMAYKYXHOGICG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)OCCc2ccc(O)cc2)cc1 |
| Water Solubility | Practically insoluble (0.074 g/L) (25 ºC) |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HMS2227C12 |
| p-hydroxyphenethyl anisate |
| 2-(4-Hydroxyphenyl)ethyl 4-methoxybenzoate |
| Benzoic acid, 4-methoxy-, 2-(4-hydroxyphenyl)ethyl ester |
| 4-Methoxybenzoic acid 2-(4-hydroxyphenyl)ethyl ester |
| Hydroxyphenethylanisate, 4- |