8-(nitromethyl)-1,4-dioxaspiro[4.5]decan-8-ol structure
|
Common Name | 8-(nitromethyl)-1,4-dioxaspiro[4.5]decan-8-ol | ||
|---|---|---|---|---|
| CAS Number | 879514-21-3 | Molecular Weight | 217.21900 | |
| Density | 1.33g/cm3 | Boiling Point | 383.73ºC at 760 mmHg | |
| Molecular Formula | C9H15NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 185.873ºC | |
| Name | 8-(nitromethyl)-1,4-dioxaspiro[4.5]decan-8-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 383.73ºC at 760 mmHg |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.21900 |
| Flash Point | 185.873ºC |
| Exact Mass | 217.09500 |
| PSA | 84.51000 |
| LogP | 0.83450 |
| Index of Refraction | 1.533 |
| InChIKey | HUDVAVREBBQAOY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])CC1(O)CCC2(CC1)OCCO2 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
|
~40%
8-(nitromethyl)... CAS#:879514-21-3 |
| Literature: 3M INNOVATIVE PROPERTIES COMPANY Patent: WO2006/28545 A2, 2006 ; Location in patent: Page/Page column 99 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| qc-9833 |