WAY-327530 structure
|
Common Name | WAY-327530 | ||
|---|---|---|---|---|
| CAS Number | 879595-66-1 | Molecular Weight | 346.38 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H18N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-327530cannabinoid CB2 receptor modulator |
| Name | WAY-327530 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.38 |
| Exact Mass | 346.142975 |
| LogP | 2.43 |
| Index of Refraction | 1.667 |
| InChIKey | WJSRHXKYJZWAKH-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2nc3cnccn3c2Nc2ccc(C)cc2)ccc1O |
| 2-Methoxy-4-{3-[(4-methylphenyl)amino]imidazo[1,2-a]pyrazin-2-yl}phenol |
| Phenol, 2-methoxy-4-[3-[(4-methylphenyl)amino]imidazo[1,2-a]pyrazin-2-yl]- |