4-amino-2,3,5-trichloro-4-hydroxycyclohexa-2,5-dien-1-one structure
|
Common Name | 4-amino-2,3,5-trichloro-4-hydroxycyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 87963-48-2 | Molecular Weight | 228.46000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-amino-2,3,5-trichloro-4-hydroxycyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H4Cl3NO2 |
|---|---|
| Molecular Weight | 228.46000 |
| Exact Mass | 226.93100 |
| PSA | 63.32000 |
| LogP | 1.72860 |
| InChIKey | QDVXVZIZVUMOOX-UHFFFAOYSA-N |
| SMILES | NC1(O)C(Cl)=CC(=O)C(Cl)=C1Cl |
|
~%
4-amino-2,3,5-t... CAS#:87963-48-2 |
| Literature: Chudek, John A.; Foster, Roy; Reid, Francis J. Journal of the Chemical Society, Chemical Communications, 1983 , # 13 p. 726 - 727 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2,5-Cyclohexadien-1-one,4-amino-2,3,5-trichloro-4-hydroxy |