1-(6-hydroxy-2H-benzo[h]chromen-5-yl)ethanone structure
|
Common Name | 1-(6-hydroxy-2H-benzo[h]chromen-5-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 87976-22-5 | Molecular Weight | 240.25400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(6-hydroxy-2H-benzo[h]chromen-5-yl)ethanone |
|---|
| Molecular Formula | C15H12O3 |
|---|---|
| Molecular Weight | 240.25400 |
| Exact Mass | 240.07900 |
| PSA | 46.53000 |
| LogP | 3.15360 |
| InChIKey | ORYRLYVFXMTLQW-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c2c(c3ccccc3c1O)OCC=C2 |
|
~2%
1-(6-hydroxy-2H... CAS#:87976-22-5 |
| Literature: Giles, Robin G.F.; Green, Ivan R.; Hugo, Victor I.; Mitchell, Peter R.K.; Yorke, Selwyn C. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2309 - 2313 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |