4-(5,6,7,8-TETRAHYDRO-NAPHTHALEN-2-YL)THIAZOL-2-YLAMINE structure
|
Common Name | 4-(5,6,7,8-TETRAHYDRO-NAPHTHALEN-2-YL)THIAZOL-2-YLAMINE | ||
|---|---|---|---|---|
| CAS Number | 87999-04-0 | Molecular Weight | 230.32900 | |
| Density | 1.234g/cm3 | Boiling Point | 435.3ºC at 760 mmHg | |
| Molecular Formula | C13H14N2S | Melting Point | 105-110℃ | |
| MSDS | Chinese USA | Flash Point | 217ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(5,6,7,8-tetrahydronaphthalen-2-yl)-1,3-thiazol-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 435.3ºC at 760 mmHg |
| Melting Point | 105-110℃ |
| Molecular Formula | C13H14N2S |
| Molecular Weight | 230.32900 |
| Flash Point | 217ºC |
| Exact Mass | 230.08800 |
| PSA | 67.15000 |
| LogP | 3.85230 |
| Index of Refraction | 1.653 |
| InChIKey | XCDNQJNJCJJQEC-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccc3c(c2)CCCC3)cs1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Phrases | 36/37/38 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934100090 |
|
~%
4-(5,6,7,8-TETR... CAS#:87999-04-0 |
| Literature: Journal of Medicinal Chemistry, , vol. 26, # 8 p. 1158 - 1163 |
|
~%
4-(5,6,7,8-TETR... CAS#:87999-04-0 |
| Literature: Journal of Medicinal Chemistry, , vol. 26, # 8 p. 1158 - 1163 |
|
~%
4-(5,6,7,8-TETR... CAS#:87999-04-0 |
| Literature: Bulletin de la Societe Chimique de France, , p. 1437,1440 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| f3099-5549 |