3-(3-methoxyphenyl)-1H-pyrazole-4-carboxylic acid structure
|
Common Name | 3-(3-methoxyphenyl)-1H-pyrazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 879996-71-1 | Molecular Weight | 218.20900 | |
| Density | 1.34g/cm3 | Boiling Point | 448.8ºC at 760 mmHg | |
| Molecular Formula | C11H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-(3-methoxyphenyl)-1H-pyrazole-4-carboxylic acid |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 448.8ºC at 760 mmHg |
| Molecular Formula | C11H10N2O3 |
| Molecular Weight | 218.20900 |
| Flash Point | 225.2ºC |
| Exact Mass | 218.06900 |
| PSA | 75.21000 |
| LogP | 1.78350 |
| Index of Refraction | 1.617 |
| InChIKey | VVUVPSNFYCNORL-UHFFFAOYSA-N |
| SMILES | COc1cccc(-c2[nH]ncc2C(=O)O)c1 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |