2-anilino-5-nitrobenzenesulphonic acid
Modify Date: 2025-09-01 20:18:03
2-anilino-5-nitrobenzenesulphonic acid structure
|
Common Name | 2-anilino-5-nitrobenzenesulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 88-35-7 | Molecular Weight | 294.28300 | |
| Density | 1.548g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H10N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-anilino-5-nitrobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.548g/cm3 |
|---|---|
| Molecular Formula | C12H10N2O5S |
| Molecular Weight | 294.28300 |
| Exact Mass | 294.03100 |
| PSA | 120.60000 |
| LogP | 4.26210 |
| Index of Refraction | 1.675 |
| InChIKey | NEPCHOJJTQMEKY-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Nc2ccccc2)c(S(=O)(=O)O)c1 |
| HS Code | 2921499090 |
|---|
|
~%
2-anilino-5-nit... CAS#:88-35-7 |
| Literature: Ullmann; Dahmen Chemische Berichte, 1908 , vol. 41, p. 3746 |
|
~%
2-anilino-5-nit... CAS#:88-35-7 |
| Literature: Fischer,P. Chemische Berichte, 1891 , vol. 24, p. 3797 |
|
~%
2-anilino-5-nit... CAS#:88-35-7 |
| Literature: Ullmann; Dahmen Chemische Berichte, 1908 , vol. 41, p. 3746 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Nitro-diphenylamino-2-sulfonsaeure |
| EINECS 201-824-5 |
| 2-anilino-5-nitro-benzenesulfonic acid |
| 2-Anilino-5-nitrobenzenesulphonic acid |
| 2-Anilino-5-nitro-benzolsulfonsaeure |