2,5-Dichloro-3-nitrobenzoic acid structure
|
Common Name | 2,5-Dichloro-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 88-86-8 | Molecular Weight | 236.009 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 366.5±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H3Cl2NO4 | Melting Point | 216-220 °C(lit.) | |
| MSDS | USA | Flash Point | 175.5±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,5-Dichloro-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 366.5±42.0 °C at 760 mmHg |
| Melting Point | 216-220 °C(lit.) |
| Molecular Formula | C7H3Cl2NO4 |
| Molecular Weight | 236.009 |
| Flash Point | 175.5±27.9 °C |
| Exact Mass | 234.943909 |
| PSA | 83.12000 |
| LogP | 2.79 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | AUAXYMOBWXOEQD-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(Cl)cc([N+](=O)[O-])c1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | DG7875000 |
|
~66%
2,5-Dichloro-3-... CAS#:88-86-8 |
| Literature: EPIZYME, INC.; EISAI CO., LTD.; KUNTZ, Kevin, Wayne; CHESWORTH, Richard; DUNCAN, Kenneth, William; KEILHACK, Heike; WARHOLIC, Natalie; KLAUS, Christine; ZHENG, Wanjun Patent: WO2012/142513 A1, 2012 ; Location in patent: Page/Page column 280 ; WO 2012/142513 A1 |
|
~88%
2,5-Dichloro-3-... CAS#:88-86-8 |
| Literature: Amchem Products Inc. Patent: US4252979 A1, 1981 ; |
|
~%
2,5-Dichloro-3-... CAS#:88-86-8 |
| Literature: Journal of the Chemical Society, , p. 2381 |
|
~%
2,5-Dichloro-3-... CAS#:88-86-8 |
| Literature: Journal of the Chemical Society, , p. 2381 |
|
Auxin activity of substituted benzoic acids and their effect on polar auxin transport.
Plant Physiol. 41(10) , 1561-9, (1966) Six dichloro-, 3 trichloro-, 2 triiodo-, and 3 heterosubstituted benzoic acids (amiben, dinoben, dicamba), and N-1-naphthylphthalamic acid have been tested for effects on growth and on polar auxin tra... |
| 2,5-dichloro-3-nitro-benzoic acid |
| MFCD00014691 |
| 2,5-Dichlor-3-nitro-benzoesaeure |
| EINECS 201-862-2 |
| dinoben:2,5-dichloro-3-nitrobenzoic acid |
| Benzoic acid,2,5-dichloro-3-nitro |
| 3-Nitro-2,5-dichlorobenzoic acid |
| 2,5-dichloro-3-nitrobezoic acid |
| 2,5-Dichloro-3-nitrobenzoic acid |
| Caswell No. 312 |
| DINOBEN |