5,7-Dimethoxy-1-indanone structure
|
Common Name | 5,7-Dimethoxy-1-indanone | ||
|---|---|---|---|---|
| CAS Number | 880-87-5 | Molecular Weight | 192.211 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 352.6±42.0 °C at 760 mmHg | |
| Molecular Formula | C11H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.3±14.3 °C | |
| Name | 5,7-dimethoxy-2,3-dihydroinden-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 352.6±42.0 °C at 760 mmHg |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.211 |
| Flash Point | 158.3±14.3 °C |
| Exact Mass | 192.078644 |
| PSA | 35.53000 |
| LogP | 2.27 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | ZLTCXTRHEQUDGV-UHFFFAOYSA-N |
| SMILES | COc1cc2c(c(OC)c1)C(=O)CC2 |
| HS Code | 2914509090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 7 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5,7-DIMETHOXY-INDAN-1-ONE |
| 2,3-Dihydro-5,7-dimethoxy-1H-inden-1-on |
| 5,7-Dimethoxy-1-indanone |
| 5,7-dimethoxyindan-1-one |
| 5,7-dimethoxyindanone |
| 5,7-dimethoxy-2,3-dihydro-1H-inden-1-one |
| ethyl 5,7-dimethoxyindan-1-one |