3,5-Dimethoxyphenylpropionic acid
3,5-Dimethoxyphenylpropionic acid structure
|
Common Name | 3,5-Dimethoxyphenylpropionic acid | ||
|---|---|---|---|---|
| CAS Number | 717-94-2 | Molecular Weight | 210.227 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 363.8±27.0 °C at 760 mmHg | |
| Molecular Formula | C11H14O4 | Melting Point | 60-62ºC | |
| MSDS | N/A | Flash Point | 141.1±17.2 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(3,5-Dimethoxyphenyl)propionic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 363.8±27.0 °C at 760 mmHg |
| Melting Point | 60-62ºC |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.227 |
| Flash Point | 141.1±17.2 °C |
| Exact Mass | 210.089203 |
| PSA | 55.76000 |
| LogP | 1.55 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | LMBOJOXVLORKSQ-UHFFFAOYSA-N |
| SMILES | COc1cc(CCC(=O)O)cc(OC)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2918990090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 9 | |
CAS#:20767-04-8
CAS#:16909-11-8
CAS#:7311-34-4![5-[(3,5-dimethoxyphenyl)methyl]-2,2-dimethyl-1,3-dioxane-4,6-dione Structure](https://image.chemsrc.com/caspic/342/618084-27-8.png)
CAS#:618084-27-8
CAS#:6652-32-0
CAS#:105-53-3
CAS#:886-51-1
CAS#:10272-07-8
CAS#:41514-66-3
CAS#:880-87-5
CAS#:1132-21-4
CAS#:69636-83-5
CAS#:76842-67-6
CAS#:76842-70-1
CAS#:82218-06-2
CAS#:883-07-8
CAS#:61262-81-5
CAS#:64052-90-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| MFCD03425685 |
| 3-(3,4-Dimethoxyphenyl)propanoic acid |
| 3-(3,5-Dimethoxyphenyl)propanoic acid |
| 3,5-Dimethoxyphenylpropionic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of 3-(3,5-Dimethoxyphenyl)propionic acid? |
| A: Boiling point of 3-(3,5-Dimethoxyphenyl)propionic acid is 363.8±27.0 °C at 760 mmHg. |
| Q: What is the melting point of 3-(3,5-Dimethoxyphenyl)propionic acid? |
| A: Melting point of 3-(3,5-Dimethoxyphenyl)propionic acid is 60-62ºC. |
| Q: What is the InChIKey of 3-(3,5-Dimethoxyphenyl)propionic acid? |
| A: InChIKey of 3-(3,5-Dimethoxyphenyl)propionic acid is LMBOJOXVLORKSQ-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3-(3,5-Dimethoxyphenyl)propionic acid? |
| A: Polar surface area (PSA) of 3-(3,5-Dimethoxyphenyl)propionic acid is 55.76000. |
| Q: What is the molecular formula of 3-(3,5-Dimethoxyphenyl)propionic acid? |
| A: Molecular formula of 3-(3,5-Dimethoxyphenyl)propionic acid is C11H14O4. |
| Q: What is the molecular weight of 3-(3,5-Dimethoxyphenyl)propionic acid? |
| A: Molecular weight of 3-(3,5-Dimethoxyphenyl)propionic acid is 210.227. |
| Q: What is the LogP of 3-(3,5-Dimethoxyphenyl)propionic acid? |
| A: LogP of 3-(3,5-Dimethoxyphenyl)propionic acid is 1.55. |
| Q: What is the safety information for 3-(3,5-Dimethoxyphenyl)propionic acid? |
| A: Safety information for 3-(3,5-Dimethoxyphenyl)propionic acid: 26-36/37/39. |
| Q: What is the SMILES notation of 3-(3,5-Dimethoxyphenyl)propionic acid? |
| A: SMILES notation of 3-(3,5-Dimethoxyphenyl)propionic acid is COc1cc(CCC(=O)O)cc(OC)c1. |
| Q: What are the upstream materials of 3-(3,5-Dimethoxyphenyl)propionic acid? |
| A: Related upstream materials(CAS) of 3-(3,5-Dimethoxyphenyl)propionic acid: 20767-04-8;16909-11-8;7311-34-4;618084-27-8;6652-32-0;105-53-3;886-51-1;10272-07-8;41514-66-3. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |