1-METHYL-4-NITRONAPHTHALENE structure
|
Common Name | 1-METHYL-4-NITRONAPHTHALENE | ||
|---|---|---|---|---|
| CAS Number | 880-93-3 | Molecular Weight | 187.19500 | |
| Density | 1.234g/cm3 | Boiling Point | 337.6ºC at 760 mmHg | |
| Molecular Formula | C11H9NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165ºC | |
| Name | 1-methyl-4-nitronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234g/cm3 |
|---|---|
| Boiling Point | 337.6ºC at 760 mmHg |
| Molecular Formula | C11H9NO2 |
| Molecular Weight | 187.19500 |
| Flash Point | 165ºC |
| Exact Mass | 187.06300 |
| PSA | 45.82000 |
| LogP | 3.57960 |
| Index of Refraction | 1.652 |
| InChIKey | FRLVKAJKOYFHKQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c2ccccc12 |
| HS Code | 2904209090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4-Methyl-1-nitro-naphthalin |
| 4-Methyl-1-nitronaphthalene |
| 1-methyl-4-nitro-naphthalene |
| Naphthalene,1-methyl-4-nitro |
| 1-Nitro-4-methyl-naphthalin |
| 4-nitro-1-methylnaphthalene |
| 1-Methyl-4-nitro-naphthalin |