1-(bromomethyl)-4-nitronaphthalene structure
|
Common Name | 1-(bromomethyl)-4-nitronaphthalene | ||
|---|---|---|---|---|
| CAS Number | 16855-41-7 | Molecular Weight | 266.09100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(bromomethyl)-4-nitronaphthalene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H8BrNO2 |
|---|---|
| Molecular Weight | 266.09100 |
| Exact Mass | 264.97400 |
| PSA | 45.82000 |
| LogP | 4.16610 |
| InChIKey | SJOQNSWOKVTGMG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(CBr)c2ccccc12 |
| HS Code | 2904909090 |
|---|
|
~%
1-(bromomethyl)... CAS#:16855-41-7 |
| Literature: Canadian Journal of Chemistry, , vol. 59, p. 2629 - 2641 |
|
~20%
1-(bromomethyl)... CAS#:16855-41-7 |
| Literature: Canadian Journal of Chemistry, , vol. 59, p. 2629 - 2641 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Naphthalene,1-(bromomethyl)-4-nitro |
| 1-Bromomethyl-4-nitronaphthalene |