2,5-dimethyl-3-phenacylcyclohexa-2,5-diene-1,4-dione structure
|
Common Name | 2,5-dimethyl-3-phenacylcyclohexa-2,5-diene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 88008-05-3 | Molecular Weight | 254.28100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-dimethyl-3-phenacylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H14O3 |
|---|---|
| Molecular Weight | 254.28100 |
| Exact Mass | 254.09400 |
| PSA | 51.21000 |
| LogP | 2.67400 |
| InChIKey | YRFQJZQCNSQEMU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(C)=C(CC(=O)c2ccccc2)C1=O |
|
~0%
2,5-dimethyl-3-... CAS#:88008-05-3
Detail
|
| Literature: Aldersley, Michael F.; Dean, Francis M.; Nayyir-Mazhir, Rassoul Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 8 p. 1753 - 1757 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,5-dimethyl-3-phenacyl-1,4-benzoquinone |