1-(5-chloro-2-hydroxyphenyl)-3-morpholin-4-ylprop-2-en-1-one structure
|
Common Name | 1-(5-chloro-2-hydroxyphenyl)-3-morpholin-4-ylprop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 88021-78-7 | Molecular Weight | 267.70800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(5-chloro-2-hydroxyphenyl)-3-morpholin-4-ylprop-2-en-1-one |
|---|
| Molecular Formula | C13H14ClNO3 |
|---|---|
| Molecular Weight | 267.70800 |
| Exact Mass | 267.06600 |
| PSA | 49.77000 |
| LogP | 2.01210 |
| InChIKey | FYNUCRFUDIOIEB-UHFFFAOYSA-N |
| SMILES | O=C(C=CN1CCOCC1)c1cc(Cl)ccc1O |
|
~%
1-(5-chloro-2-h... CAS#:88021-78-7 |
| Literature: Ghosh, Chandra Kanta; Bandyopadhyay, Chandrakanta; Morin, Christophe Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 1989 - 1994 |
|
~35%
1-(5-chloro-2-h... CAS#:88021-78-7 |
| Literature: Ghosh, Chandra Kanta; Bandyopadhyay, Chandrakanta; Morin, Christophe Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 1989 - 1994 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |