4-(4-n-propylphenyl)benzoic acid structure
|
Common Name | 4-(4-n-propylphenyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 88038-94-2 | Molecular Weight | 240.29700 | |
| Density | 1.109g/cm3 | Boiling Point | 401.5ºC at 760 mmHg | |
| Molecular Formula | C16H16O2 | Melting Point | 222-226 °C | |
| MSDS | N/A | Flash Point | 186.7ºC | |
| Name | 4-Propylbiphenyl-4-Carboxylic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 401.5ºC at 760 mmHg |
| Melting Point | 222-226 °C |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.29700 |
| Flash Point | 186.7ºC |
| Exact Mass | 240.11500 |
| PSA | 37.30000 |
| LogP | 4.00430 |
| Index of Refraction | 1.578 |
| InChIKey | HCPBURTZSXRGBN-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(-c2ccc(C(=O)O)cc2)cc1 |
| Stability | Stable. Incompatible with bases, oxidizing agents. Combustible. |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25-S22 |
| HS Code | 2916399090 |
|
~68%
4-(4-n-propylph... CAS#:88038-94-2 |
| Literature: Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, , vol. 55, # 7 p. 567 - 575 |
|
~%
4-(4-n-propylph... CAS#:88038-94-2 |
| Literature: US2003/211421 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-(4-propylphenyl)benzoic acid |
| MFCD00017335 |