2-chloro-1-cyclohexyl-3-phenylpropane-1,3-dione structure
|
Common Name | 2-chloro-1-cyclohexyl-3-phenylpropane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 88039-27-4 | Molecular Weight | 264.74700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H17ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-1-cyclohexyl-3-phenylpropane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H17ClO2 |
|---|---|
| Molecular Weight | 264.74700 |
| Exact Mass | 264.09200 |
| PSA | 34.14000 |
| LogP | 3.62610 |
| InChIKey | PKWRSDJMBNYYCA-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)C(Cl)C(=O)C1CCCCC1 |
|
~82%
2-chloro-1-cycl... CAS#:88039-27-4 |
| Literature: Barluenga, Jose; Tomas, Miguel; Lopez-Ortiz, J. Francisco; Gotor, Vicente Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2273 - 2276 |
|
~%
2-chloro-1-cycl... CAS#:88039-27-4 |
| Literature: Barluenga, Jose; Tomas, Miguel; Lopez-Ortiz, J. Francisco; Gotor, Vicente Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2273 - 2276 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,3-Propanedione,2-chloro-1-cyclohexyl-3-phenyl |