3,5,6-trichloro-1-(2-methoxyphenyl)pyridin-2-one structure
|
Common Name | 3,5,6-trichloro-1-(2-methoxyphenyl)pyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 88046-95-1 | Molecular Weight | 304.55600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8Cl3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5,6-trichloro-1-(2-methoxyphenyl)pyridin-2-one |
|---|
| Molecular Formula | C12H8Cl3NO2 |
|---|---|
| Molecular Weight | 304.55600 |
| Exact Mass | 302.96200 |
| PSA | 31.23000 |
| LogP | 3.80630 |
| InChIKey | CYJRKYXCBQQULW-UHFFFAOYSA-N |
| SMILES | COc1ccccc1-n1c(Cl)c(Cl)cc(Cl)c1=O |
|
~28%
3,5,6-trichloro... CAS#:88046-95-1 |
| Literature: Meth-Cohn, Otto; Westwood, Keith T. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2089 - 2092 |
|
~%
3,5,6-trichloro... CAS#:88046-95-1 |
| Literature: Meth-Cohn, Otto; Westwood, Keith T. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2089 - 2092 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |