O-(2-hydroxy-3-(tert-butylamino)propyl)-3,3,5-trimethylcyclohexanone oxime structure
|
Common Name | O-(2-hydroxy-3-(tert-butylamino)propyl)-3,3,5-trimethylcyclohexanone oxime | ||
|---|---|---|---|---|
| CAS Number | 88135-00-6 | Molecular Weight | 284.43700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H32N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(tert-butylamino)-3-[(E)-(3,3,5-trimethylcyclohexylidene)amino]oxypropan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H32N2O2 |
|---|---|
| Molecular Weight | 284.43700 |
| Exact Mass | 284.24600 |
| PSA | 53.85000 |
| LogP | 3.34510 |
| InChIKey | YQZGYLVYTGIJAX-QGOAFFKASA-N |
| SMILES | CC1CC(=NOCC(O)CNC(C)(C)C)CC(C)(C)C1 |
|
~%
O-(2-hydroxy-3-... CAS#:88135-00-6 |
| Literature: Bouzoubaa, Mohamed; Leclerc, Gerard; Decker, Nicole; Schwartz, Jean; Andermann, Guy Journal of Medicinal Chemistry, 1984 , vol. 27, # 10 p. 1291 - 1294 |
|
~%
O-(2-hydroxy-3-... CAS#:88135-00-6 |
| Literature: Bouzoubaa, Mohamed; Leclerc, Gerard; Decker, Nicole; Schwartz, Jean; Andermann, Guy Journal of Medicinal Chemistry, 1984 , vol. 27, # 10 p. 1291 - 1294 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| O-(2-Hydroxy-3-(tert-butylamino)propyl)-3,3,5-trimethylcyclohexanone oxime |
| O-(2-Hydroxy-3-(tert-butylamino)propyl)-3,3,5-trimethylcyclohexanone oxime oxalate |
| POS 7 |
| Cyclohexanone,3,3,5-trimethyl-,O-(3-((1,1-dimethylethyl)amino)-2-hydroxypropyl)oxime |