3β,5α,9α-Trihydroxyergosta-7,22-dien-6-one structure
|
Common Name | 3β,5α,9α-Trihydroxyergosta-7,22-dien-6-one | ||
|---|---|---|---|---|
| CAS Number | 88191-14-4 | Molecular Weight | 444.647 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 581.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C28H44O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.4±26.6 °C | |
Use of 3β,5α,9α-Trihydroxyergosta-7,22-dien-6-one3β,5α,9α-Trihydroxyergosta-7,22-dien-6-one (compound 6) can be isolated from Flammulina velutipes fruiting body[1]. |
| Name | 3,5,9-Trihydroxyergosta-7,22-dien-6-one |
|---|---|
| Synonym | More Synonyms |
| Description | 3β,5α,9α-Trihydroxyergosta-7,22-dien-6-one (compound 6) can be isolated from Flammulina velutipes fruiting body[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 581.3±50.0 °C at 760 mmHg |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.647 |
| Flash Point | 319.4±26.6 °C |
| Exact Mass | 444.323975 |
| PSA | 77.76000 |
| LogP | 5.51 |
| Vapour Pressure | 0.0±3.7 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | GUERPVMWCQXYEU-ZFZPKPCHSA-N |
| SMILES | CC(C)C(C)C=CC(C)C1CCC2C3=CC(=O)C4(O)CC(O)CCC4(C)C3(O)CCC21C |
| Hazard Codes | Xi |
|---|
| Ergosta-7,22-dien-6-one, 3,5,9-trihydroxy-, (3β,5α,22E)- |
| (3β,5α,22E)-3,5,9-Trihydroxyergosta-7,22-dien-6-one |