N-(5-HYDROXYMETHYL-PYRIDIN-2-YL)-2,2-DIMETHYL-PROPIONAMIDE structure
|
Common Name | N-(5-HYDROXYMETHYL-PYRIDIN-2-YL)-2,2-DIMETHYL-PROPIONAMIDE | ||
|---|---|---|---|---|
| CAS Number | 882016-49-1 | Molecular Weight | 208.25700 | |
| Density | 1.162g/cm3 | Boiling Point | 434.3ºC at 760 mmHg | |
| Molecular Formula | C11H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N-[5-(hydroxymethyl)pyridin-2-yl]-2,2-dimethylpropanamide |
|---|
| Density | 1.162g/cm3 |
|---|---|
| Boiling Point | 434.3ºC at 760 mmHg |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.25700 |
| Flash Point | 216.5ºC |
| Exact Mass | 208.12100 |
| PSA | 62.22000 |
| LogP | 1.63150 |
| Index of Refraction | 1.571 |
| InChIKey | ALJCDLWGLGUXGZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)Nc1ccc(CO)cn1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933399090 |
|
~%
N-(5-HYDROXYMET... CAS#:882016-49-1 |
| Literature: Amrein, Kurt; Hunziker, Daniel; Kuhn, Bernd; Mayweg, Alexander; Neidhart, Werner Patent: US2006/74237 A1, 2006 ; Location in patent: Page/Page column 27 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |