6-[5-(6-oxocyclohexa-2,4-dien-1-ylidene)-1,3,4-thiadiazolidin-2-ylidene]cyclohexa-2,4-dien-1-one structure
|
Common Name | 6-[5-(6-oxocyclohexa-2,4-dien-1-ylidene)-1,3,4-thiadiazolidin-2-ylidene]cyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 88203-22-9 | Molecular Weight | 270.30600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[5-(6-oxocyclohexa-2,4-dien-1-ylidene)-1,3,4-thiadiazolidin-2-ylidene]cyclohexa-2,4-dien-1-one |
|---|
| Molecular Formula | C14H10N2O2S |
|---|---|
| Molecular Weight | 270.30600 |
| Exact Mass | 270.04600 |
| PSA | 93.96000 |
| LogP | 0.65810 |
| InChIKey | XYLFGOQEKFXWHD-UHFFFAOYSA-N |
| SMILES | Oc1ccccc1-c1nnc(-c2ccccc2O)s1 |
|
~81%
6-[5-(6-oxocycl... CAS#:88203-22-9 |
| Literature: Mazzone, Gioacchino; Puglisi, Giovanni; Bonina, Francesco; Corsaro, Antonino Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1399 - 1401 |
|
~82%
6-[5-(6-oxocycl... CAS#:88203-22-9 |
| Literature: Lebrini, Mounim; Bentiss, Fouad; Lagrenee, Michel Journal of Heterocyclic Chemistry, 2005 , vol. 42, # 5 p. 991 - 994 |
|
~%
6-[5-(6-oxocycl... CAS#:88203-22-9 |
| Literature: Jensen,K.A.; Pedersen,C. Acta Chemica Scandinavica (1947-1973), 1961 , vol. 15, p. 1124 - 1129 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |